*From WHO World Health Organization (via Toxins Awareness Group): painters having a 40% higher chance of lung cancer and 20% higher of stomach, bladder, larynx, etc cancers, |
| while their children are at increased risk of leukaemia and brain tumours. |
C6H14O2/CH3(CH2)2CH2OCH2CH2OH
Material Safety Data info on Ethylene Glycol MonoBUTYL Ether *
Causes tumors ... everywhere per UK Research,
primary harm is to liver and kidneys ... (diabetes is a side effect)
Vietnam Vets blame the wrong chemical
Are we seeing more brain tumors now a days?
Must be.
The CDC didn't even start monitoring brain tumors in the USA until 1977
Doctors do not know what the fatigue of CFS, FM, CFIDS is
If caused by 2-butoxyethanol aka Ethylene Glycol Monobutyl Ether it is AIHA or IMHA
| Some Common Thoughts * |
| Maybe Glioma Brain tumors are not all that rare? * |
| Suspect Ethylene Glycol Monobutyl Ether for Cancers, too * |
| Help your doctor/s know what you are dealing with * |
| What happened to the Vietnam Vets? * Even Brain Tumors |
| What happened to the Exxon Valdez Oil spill cleanup workers? * |
12/4/07